C16H25F3O4 — CID 126691298
(2R,3R)-3-[(2-methylpropan-2-yl)oxycarbonyl]-2-(4,4,4-trifluorobutyl)hept-6-enoic acid (PubChem CID 126691298) has the molecular formula C16H25F3O4 and a molecular weight of 338.37 g/mol. Its IUPAC name is (2R,3R)-3-[(2-methylpropan-2-yl)oxycarbonyl]-2-(4,4,4-trifluorobutyl)hept-6-enoic acid.
| Compound Name | (2R,3R)-3-[(2-methylpropan-2-yl)oxycarbonyl]-2-(4,4,4-trifluorobutyl)hept-6-enoic acid |
|---|---|
| PubChem CID | 126691298 |
| Molecular Formula | C16H25F3O4 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (2R,3R)-3-[(2-methylpropan-2-yl)oxycarbonyl]-2-(4,4,4-trifluorobutyl)hept-6-enoic acid |
| SMILES | C=CCC[C@@H](C(=O)OC(C)(C)C)[C@@H](CCCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C16H25F3O4/c1-5-6-8-12(14(22)23-15(2,3)4)11(13(20)21)9-7-10-16(17,18)19/h5,11-12H,1,6-10H2,2-4H3,(H,20,21)/t11-,12-/m1/s1 |
| InChIKey | IGVDVLHKUAVTGN-VXGBXAGGSA-N |
| XLogP | 4.34 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|