C23H21N7OS — CID 126691396
2-[(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)methyl]-1-[(2R,4R)-2-methyloxan-4-yl]imidazo[4,5-c]quinoline-8-carbonitrile (PubChem CID 126691396) has the molecular formula C23H21N7OS and a molecular weight of 443.54 g/mol. Its IUPAC name is 2-[(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)methyl]-1-[(2R,4R)-2-methyloxan-4-yl]imidazo[4,5-c]quinoline-8-carbonitrile.
| Compound Name | 2-[(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)methyl]-1-[(2R,4R)-2-methyloxan-4-yl]imidazo[4,5-c]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 126691396 |
| Molecular Formula | C23H21N7OS |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 2-[(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)methyl]-1-[(2R,4R)-2-methyloxan-4-yl]imidazo[4,5-c]quinoline-8-carbonitrile |
| SMILES | Cc1nn2cc(Cc3nc4cnc5ccc(C#N)cc5c4n3[C@@H]3CCO[C@H](C)C3)nc2s1 |
| InChI | InChI=1S/C23H21N7OS/c1-13-7-17(5-6-31-13)30-21(9-16-12-29-23(26-16)32-14(2)28-29)27-20-11-25-19-4-3-15(10-24)8-18(19)22(20)30/h3-4,8,11-13,17H,5-7,9H2,1-2H3/t13-,17-/m1/s1 |
| InChIKey | KECXJZVVOPGFGQ-CXAGYDPISA-N |
| XLogP | 4.20 |
| TPSA | 93.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |