C8H11N3 — CID 126691479
1,5,6,8a-tetrahydro-1,6-naphthyridin-5-amine (PubChem CID 126691479) has the molecular formula C8H11N3 and a molecular weight of 149.20 g/mol. Its IUPAC name is 1,5,6,8a-tetrahydro-1,6-naphthyridin-5-amine.
| Compound Name | 1,5,6,8a-tetrahydro-1,6-naphthyridin-5-amine |
|---|---|
| PubChem CID | 126691479 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 1,5,6,8a-tetrahydro-1,6-naphthyridin-5-amine |
| SMILES | NC1NC=CC2NC=CC=C12 |
| InChI | InChI=1S/C8H11N3/c9-8-6-2-1-4-10-7(6)3-5-11-8/h1-5,7-8,10-11H,9H2 |
| InChIKey | OPASQIYQQGGQQY-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |