About 1-phenyl-4,5-bis(trifluoromethyl)triazole
1-phenyl-4,5-bis(trifluoromethyl)triazole (PubChem CID 12669189) has the molecular formula C10H5F6N3
and a molecular weight of 281.16 g/mol. Its IUPAC name is 1-phenyl-4,5-bis(trifluoromethyl)triazole.
Molecular Properties
| Compound Name | 1-phenyl-4,5-bis(trifluoromethyl)triazole |
| PubChem CID | 12669189 |
| Molecular Formula | C10H5F6N3 |
| Molecular Weight | 281.16 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 1-phenyl-4,5-bis(trifluoromethyl)triazole |
| SMILES | FC(F)(F)c1nnn(-c2ccccc2)c1C(F)(F)F |
| InChI | InChI=1S/C10H5F6N3/c11-9(12,13)7-8(10(14,15)16)19(18-17-7)6-4-2-1-3-5-6/h1-5H |
| InChIKey | QQBYJQOEUDPIDM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.16 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-phenyl-4,5-bis(trifluoromethyl)triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-4,5-bis(trifluoromethyl)triazole?
The IUPAC name of 1-phenyl-4,5-bis(trifluoromethyl)triazole (CID 12669189) is 1-phenyl-4,5-bis(trifluoromethyl)triazole.
What is the SMILES notation for 1-phenyl-4,5-bis(trifluoromethyl)triazole?
The canonical SMILES for 1-phenyl-4,5-bis(trifluoromethyl)triazole is FC(F)(F)c1nnn(-c2ccccc2)c1C(F)(F)F.
What is the InChIKey of 1-phenyl-4,5-bis(trifluoromethyl)triazole?
The InChIKey is QQBYJQOEUDPIDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5F6N3/c11-9(12,13)7-8(10(14,15)16)19(18-17-7)6-4-2-1-3-5-6/h1-5H.
What are the key properties of 1-phenyl-4,5-bis(trifluoromethyl)triazole?
1-phenyl-4,5-bis(trifluoromethyl)triazole has a molecular weight of 281.16 g/mol, XLogP of 3.30, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-4,5-bis(trifluoromethyl)triazole is sourced from PubChem (CID 12669189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).