C9H9BrFN — CID 126692242
2-bromo-7-fluoro-1,5,6,8a-tetrahydroquinoline (PubChem CID 126692242) has the molecular formula C9H9BrFN and a molecular weight of 230.08 g/mol. Its IUPAC name is 2-bromo-7-fluoro-1,5,6,8a-tetrahydroquinoline.
| Compound Name | 2-bromo-7-fluoro-1,5,6,8a-tetrahydroquinoline |
|---|---|
| PubChem CID | 126692242 |
| Molecular Formula | C9H9BrFN |
| Molecular Weight | 230.08 g/mol |
| Exact Mass | 228.99 |
| IUPAC Name | 2-bromo-7-fluoro-1,5,6,8a-tetrahydroquinoline |
| SMILES | FC1=CC2NC(Br)=CC=C2CC1 |
| InChI | InChI=1S/C9H9BrFN/c10-9-4-2-6-1-3-7(11)5-8(6)12-9/h2,4-5,8,12H,1,3H2 |
| InChIKey | HMSXUHFGUPDHRL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.08 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|