About 1-acetyl-3H-thieno[2,3-d]imidazol-2-one
1-acetyl-3H-thieno[2,3-d]imidazol-2-one (PubChem CID 12669248) has the molecular formula C7H6N2O2S
and a molecular weight of 182.20 g/mol. Its IUPAC name is 1-acetyl-3H-thieno[2,3-d]imidazol-2-one.
Molecular Properties
| Compound Name | 1-acetyl-3H-thieno[2,3-d]imidazol-2-one |
| PubChem CID | 12669248 |
| Molecular Formula | C7H6N2O2S |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.01 |
| IUPAC Name | 1-acetyl-3H-thieno[2,3-d]imidazol-2-one |
| SMILES | CC(=O)n1c(=O)[nH]c2sccc21 |
| InChI | InChI=1S/C7H6N2O2S/c1-4(10)9-5-2-3-12-6(5)8-7(9)11/h2-3H,1H3,(H,8,11) |
| InChIKey | QQQUMFNTXKTVKO-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-acetyl-3H-thieno[2,3-d]imidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-acetyl-3H-thieno[2,3-d]imidazol-2-one?
The IUPAC name of 1-acetyl-3H-thieno[2,3-d]imidazol-2-one (CID 12669248) is 1-acetyl-3H-thieno[2,3-d]imidazol-2-one.
What is the SMILES notation for 1-acetyl-3H-thieno[2,3-d]imidazol-2-one?
The canonical SMILES for 1-acetyl-3H-thieno[2,3-d]imidazol-2-one is CC(=O)n1c(=O)[nH]c2sccc21.
What is the InChIKey of 1-acetyl-3H-thieno[2,3-d]imidazol-2-one?
The InChIKey is QQQUMFNTXKTVKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O2S/c1-4(10)9-5-2-3-12-6(5)8-7(9)11/h2-3H,1H3,(H,8,11).
What are the key properties of 1-acetyl-3H-thieno[2,3-d]imidazol-2-one?
1-acetyl-3H-thieno[2,3-d]imidazol-2-one has a molecular weight of 182.20 g/mol, XLogP of 1.05, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetyl-3H-thieno[2,3-d]imidazol-2-one is sourced from PubChem (CID 12669248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).