About [(6E)-2,4-dimethoxy-6-[(Z)-pent-2-enylidene]cyclohexa-1,3-dien-1-yl]-trimethyl-λ4-sulfane
[(6E)-2,4-dimethoxy-6-[(Z)-pent-2-enylidene]cyclohexa-1,3-dien-1-yl]-trimethyl-λ4-sulfane (PubChem CID 126692513) has the molecular formula C16H26O2S
and a molecular weight of 282.45 g/mol. Its IUPAC name is [(6E)-2,4-dimethoxy-6-[(Z)-pent-2-enylidene]cyclohexa-1,3-dien-1-yl]-trimethyl-λ4-sulfane.
Molecular Properties
| Compound Name | [(6E)-2,4-dimethoxy-6-[(Z)-pent-2-enylidene]cyclohexa-1,3-dien-1-yl]-trimethyl-λ4-sulfane |
| PubChem CID | 126692513 |
| Molecular Formula | C16H26O2S |
| Molecular Weight | 282.45 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | [(6E)-2,4-dimethoxy-6-[(Z)-pent-2-enylidene]cyclohexa-1,3-dien-1-yl]-trimethyl-λ4-sulfane |
| SMILES | CC/C=C\C=C1/CC(OC)=CC(OC)=C1S(C)(C)C |
| InChI | InChI=1S/C16H26O2S/c1-7-8-9-10-13-11-14(17-2)12-15(18-3)16(13)19(4,5)6/h8-10,12H,7,11H2,1-6H3/b9-8-,13-10+ |
| InChIKey | JKKKDNYUARVYDG-JQHRQWORSA-N |
| XLogP | 4.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(6E)-2,4-dimethoxy-6-[(Z)-pent-2-enylidene]cyclohexa-1,3-dien-1-yl]-trimethyl-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(6E)-2,4-dimethoxy-6-[(Z)-pent-2-enylidene]cyclohexa-1,3-dien-1-yl]-trimethyl-λ4-sulfane?
The IUPAC name of [(6E)-2,4-dimethoxy-6-[(Z)-pent-2-enylidene]cyclohexa-1,3-dien-1-yl]-trimethyl-λ4-sulfane (CID 126692513) is [(6E)-2,4-dimethoxy-6-[(Z)-pent-2-enylidene]cyclohexa-1,3-dien-1-yl]-trimethyl-λ4-sulfane.
What is the SMILES notation for [(6E)-2,4-dimethoxy-6-[(Z)-pent-2-enylidene]cyclohexa-1,3-dien-1-yl]-trimethyl-λ4-sulfane?
The canonical SMILES for [(6E)-2,4-dimethoxy-6-[(Z)-pent-2-enylidene]cyclohexa-1,3-dien-1-yl]-trimethyl-λ4-sulfane is CC/C=C\C=C1/CC(OC)=CC(OC)=C1S(C)(C)C.
What is the InChIKey of [(6E)-2,4-dimethoxy-6-[(Z)-pent-2-enylidene]cyclohexa-1,3-dien-1-yl]-trimethyl-λ4-sulfane?
The InChIKey is JKKKDNYUARVYDG-JQHRQWORSA-N. The full InChI is InChI=1S/C16H26O2S/c1-7-8-9-10-13-11-14(17-2)12-15(18-3)16(13)19(4,5)6/h8-10,12H,7,11H2,1-6H3/b9-8-,13-10+.
What are the key properties of [(6E)-2,4-dimethoxy-6-[(Z)-pent-2-enylidene]cyclohexa-1,3-dien-1-yl]-trimethyl-λ4-sulfane?
[(6E)-2,4-dimethoxy-6-[(Z)-pent-2-enylidene]cyclohexa-1,3-dien-1-yl]-trimethyl-λ4-sulfane has a molecular weight of 282.45 g/mol, XLogP of 4.36, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(6E)-2,4-dimethoxy-6-[(Z)-pent-2-enylidene]cyclohexa-1,3-dien-1-yl]-trimethyl-λ4-sulfane is sourced from PubChem (CID 126692513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).