C21H22N6O2S — CID 126692629
8-(1,3-benzodioxol-5-yl)-N-[[1-(3-methyl-1,2-thiazol-5-yl)azetidin-3-ylidene]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 126692629) has the molecular formula C21H22N6O2S and a molecular weight of 422.51 g/mol. Its IUPAC name is 8-(1,3-benzodioxol-5-yl)-N-[[1-(3-methyl-1,2-thiazol-5-yl)azetidin-3-ylidene]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 8-(1,3-benzodioxol-5-yl)-N-[[1-(3-methyl-1,2-thiazol-5-yl)azetidin-3-ylidene]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 126692629 |
| Molecular Formula | C21H22N6O2S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 8-(1,3-benzodioxol-5-yl)-N-[[1-(3-methyl-1,2-thiazol-5-yl)azetidin-3-ylidene]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1cc(N2CC(=CNc3nc4n(n3)CCCC4c3ccc4c(c3)OCO4)C2)sn1 |
| InChI | InChI=1S/C21H22N6O2S/c1-13-7-19(30-25-13)26-10-14(11-26)9-22-21-23-20-16(3-2-6-27(20)24-21)15-4-5-17-18(8-15)29-12-28-17/h4-5,7-9,16H,2-3,6,10-12H2,1H3,(H,22,24) |
| InChIKey | UIBWAYMAMUOWMJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 77.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |