About 1-[(9S)-7,11-dimethoxy-9-methyl-9H-cyclohepta[b]naphthalen-5-yl]-1-methylthiolane
1-[(9S)-7,11-dimethoxy-9-methyl-9H-cyclohepta[b]naphthalen-5-yl]-1-methylthiolane (PubChem CID 126692651) has the molecular formula C23H28O2S
and a molecular weight of 368.54 g/mol. Its IUPAC name is 1-[(9S)-7,11-dimethoxy-9-methyl-9H-cyclohepta[b]naphthalen-5-yl]-1-methylthiolane.
Molecular Properties
| Compound Name | 1-[(9S)-7,11-dimethoxy-9-methyl-9H-cyclohepta[b]naphthalen-5-yl]-1-methylthiolane |
| PubChem CID | 126692651 |
| Molecular Formula | C23H28O2S |
| Molecular Weight | 368.54 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 1-[(9S)-7,11-dimethoxy-9-methyl-9H-cyclohepta[b]naphthalen-5-yl]-1-methylthiolane |
| SMILES | COC1=C[C@@H](C)C=c2c(OC)c3ccccc3c(S3(C)CCCC3)c2=C1 |
| InChI | InChI=1S/C23H28O2S/c1-16-13-17(24-2)15-21-20(14-16)22(25-3)18-9-5-6-10-19(18)23(21)26(4)11-7-8-12-26/h5-6,9-10,13-16H,7-8,11-12H2,1-4H3/t16-/m1/s1 |
| InChIKey | BKABZADJNNNSIN-MRXNPFEDSA-N |
| XLogP | 4.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(9S)-7,11-dimethoxy-9-methyl-9H-cyclohepta[b]naphthalen-5-yl]-1-methylthiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(9S)-7,11-dimethoxy-9-methyl-9H-cyclohepta[b]naphthalen-5-yl]-1-methylthiolane?
The IUPAC name of 1-[(9S)-7,11-dimethoxy-9-methyl-9H-cyclohepta[b]naphthalen-5-yl]-1-methylthiolane (CID 126692651) is 1-[(9S)-7,11-dimethoxy-9-methyl-9H-cyclohepta[b]naphthalen-5-yl]-1-methylthiolane.
What is the SMILES notation for 1-[(9S)-7,11-dimethoxy-9-methyl-9H-cyclohepta[b]naphthalen-5-yl]-1-methylthiolane?
The canonical SMILES for 1-[(9S)-7,11-dimethoxy-9-methyl-9H-cyclohepta[b]naphthalen-5-yl]-1-methylthiolane is COC1=C[C@@H](C)C=c2c(OC)c3ccccc3c(S3(C)CCCC3)c2=C1.
What is the InChIKey of 1-[(9S)-7,11-dimethoxy-9-methyl-9H-cyclohepta[b]naphthalen-5-yl]-1-methylthiolane?
The InChIKey is BKABZADJNNNSIN-MRXNPFEDSA-N. The full InChI is InChI=1S/C23H28O2S/c1-16-13-17(24-2)15-21-20(14-16)22(25-3)18-9-5-6-10-19(18)23(21)26(4)11-7-8-12-26/h5-6,9-10,13-16H,7-8,11-12H2,1-4H3/t16-/m1/s1.
What are the key properties of 1-[(9S)-7,11-dimethoxy-9-methyl-9H-cyclohepta[b]naphthalen-5-yl]-1-methylthiolane?
1-[(9S)-7,11-dimethoxy-9-methyl-9H-cyclohepta[b]naphthalen-5-yl]-1-methylthiolane has a molecular weight of 368.54 g/mol, XLogP of 4.18, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(9S)-7,11-dimethoxy-9-methyl-9H-cyclohepta[b]naphthalen-5-yl]-1-methylthiolane is sourced from PubChem (CID 126692651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).