C22H38O2 — CID 126692691
8,8,12,12-tetramethyl-14-prop-2-enoxypentadeca-1,14-dien-5-one (PubChem CID 126692691) has the molecular formula C22H38O2 and a molecular weight of 334.54 g/mol. Its IUPAC name is 8,8,12,12-tetramethyl-14-prop-2-enoxypentadeca-1,14-dien-5-one.
| Compound Name | 8,8,12,12-tetramethyl-14-prop-2-enoxypentadeca-1,14-dien-5-one |
|---|---|
| PubChem CID | 126692691 |
| Molecular Formula | C22H38O2 |
| Molecular Weight | 334.54 g/mol |
| Exact Mass | 334.29 |
| IUPAC Name | 8,8,12,12-tetramethyl-14-prop-2-enoxypentadeca-1,14-dien-5-one |
| SMILES | C=CCCC(=O)CCC(C)(C)CCCC(C)(C)CC(=C)OCC=C |
| InChI | InChI=1S/C22H38O2/c1-8-10-12-20(23)13-16-21(4,5)14-11-15-22(6,7)18-19(3)24-17-9-2/h8-9H,1-3,10-18H2,4-7H3 |
| InChIKey | PKQNEGFXSSYXIV-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.54 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|