C21H30O3 — CID 126692801
(6S,7aR)-7a-[(4Z,5Z)-4-ethylidene-7-methylocta-5,7-dien-2-yl]-6-propyl-6,7-dihydro-1,3-benzodioxol-5-one (PubChem CID 126692801) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is (6S,7aR)-7a-[(4Z,5Z)-4-ethylidene-7-methylocta-5,7-dien-2-yl]-6-propyl-6,7-dihydro-1,3-benzodioxol-5-one.
| Compound Name | (6S,7aR)-7a-[(4Z,5Z)-4-ethylidene-7-methylocta-5,7-dien-2-yl]-6-propyl-6,7-dihydro-1,3-benzodioxol-5-one |
|---|---|
| PubChem CID | 126692801 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | (6S,7aR)-7a-[(4Z,5Z)-4-ethylidene-7-methylocta-5,7-dien-2-yl]-6-propyl-6,7-dihydro-1,3-benzodioxol-5-one |
| SMILES | C=C(C)/C=C\C(=C/C)CC(C)[C@]12C[C@H](CCC)C(=O)C=C1OCO2 |
| InChI | InChI=1S/C21H30O3/c1-6-8-18-13-21(20(12-19(18)22)23-14-24-21)16(5)11-17(7-2)10-9-15(3)4/h7,9-10,12,16,18H,3,6,8,11,13-14H2,1-2,4-5H3/b10-9-,17-7+/t16?,18-,21+/m0/s1 |
| InChIKey | AXPGSWDLRCOAHK-ILMNOCGDSA-N |
| XLogP | 5.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|