About dimethyl-phenyl-[(E)-3-phenylprop-2-enyl]-λ4-sulfane
dimethyl-phenyl-[(E)-3-phenylprop-2-enyl]-λ4-sulfane (PubChem CID 126693424) has the molecular formula C17H20S
and a molecular weight of 256.41 g/mol. Its IUPAC name is dimethyl-phenyl-[(E)-3-phenylprop-2-enyl]-λ4-sulfane.
Molecular Properties
| Compound Name | dimethyl-phenyl-[(E)-3-phenylprop-2-enyl]-λ4-sulfane |
| PubChem CID | 126693424 |
| Molecular Formula | C17H20S |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | dimethyl-phenyl-[(E)-3-phenylprop-2-enyl]-λ4-sulfane |
| SMILES | CS(C)(C/C=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H20S/c1-18(2,17-13-7-4-8-14-17)15-9-12-16-10-5-3-6-11-16/h3-14H,15H2,1-2H3/b12-9+ |
| InChIKey | KOFSDHRPIMJPMJ-FMIVXFBMSA-N |
| XLogP | 4.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze dimethyl-phenyl-[(E)-3-phenylprop-2-enyl]-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-phenyl-[(E)-3-phenylprop-2-enyl]-λ4-sulfane?
The IUPAC name of dimethyl-phenyl-[(E)-3-phenylprop-2-enyl]-λ4-sulfane (CID 126693424) is dimethyl-phenyl-[(E)-3-phenylprop-2-enyl]-λ4-sulfane.
What is the SMILES notation for dimethyl-phenyl-[(E)-3-phenylprop-2-enyl]-λ4-sulfane?
The canonical SMILES for dimethyl-phenyl-[(E)-3-phenylprop-2-enyl]-λ4-sulfane is CS(C)(C/C=C/c1ccccc1)c1ccccc1.
What is the InChIKey of dimethyl-phenyl-[(E)-3-phenylprop-2-enyl]-λ4-sulfane?
The InChIKey is KOFSDHRPIMJPMJ-FMIVXFBMSA-N. The full InChI is InChI=1S/C17H20S/c1-18(2,17-13-7-4-8-14-17)15-9-12-16-10-5-3-6-11-16/h3-14H,15H2,1-2H3/b12-9+.
What are the key properties of dimethyl-phenyl-[(E)-3-phenylprop-2-enyl]-λ4-sulfane?
dimethyl-phenyl-[(E)-3-phenylprop-2-enyl]-λ4-sulfane has a molecular weight of 256.41 g/mol, XLogP of 4.82, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-phenyl-[(E)-3-phenylprop-2-enyl]-λ4-sulfane is sourced from PubChem (CID 126693424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).