C15H14N2 — CID 126693619
(5E,6Z)-5,6-di(ethylidene)imidazo[2,1-a]isoquinoline (PubChem CID 126693619) has the molecular formula C15H14N2 and a molecular weight of 222.29 g/mol. Its IUPAC name is (5E,6Z)-5,6-di(ethylidene)imidazo[2,1-a]isoquinoline.
| Compound Name | (5E,6Z)-5,6-di(ethylidene)imidazo[2,1-a]isoquinoline |
|---|---|
| PubChem CID | 126693619 |
| Molecular Formula | C15H14N2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | (5E,6Z)-5,6-di(ethylidene)imidazo[2,1-a]isoquinoline |
| SMILES | C/C=c1\c(=C/C)n2ccnc2c2ccccc12 |
| InChI | InChI=1S/C15H14N2/c1-3-11-12-7-5-6-8-13(12)15-16-9-10-17(15)14(11)4-2/h3-10H,1-2H3/b11-3-,14-4+ |
| InChIKey | QIPDPQZHLWFRRW-MHGHFPJLSA-N |
| XLogP | 2.09 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |