About 2,4,5-trimethyl-1,3-diphenyl-2H-imidazole
2,4,5-trimethyl-1,3-diphenyl-2H-imidazole (PubChem CID 126693775) has the molecular formula C18H20N2
and a molecular weight of 264.37 g/mol. Its IUPAC name is 2,4,5-trimethyl-1,3-diphenyl-2H-imidazole.
Molecular Properties
| Compound Name | 2,4,5-trimethyl-1,3-diphenyl-2H-imidazole |
| PubChem CID | 126693775 |
| Molecular Formula | C18H20N2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 2,4,5-trimethyl-1,3-diphenyl-2H-imidazole |
| SMILES | CC1=C(C)N(c2ccccc2)C(C)N1c1ccccc1 |
| InChI | InChI=1S/C18H20N2/c1-14-15(2)20(18-12-8-5-9-13-18)16(3)19(14)17-10-6-4-7-11-17/h4-13,16H,1-3H3 |
| InChIKey | LMPQCAMGYFLPFV-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4,5-trimethyl-1,3-diphenyl-2H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,5-trimethyl-1,3-diphenyl-2H-imidazole?
The IUPAC name of 2,4,5-trimethyl-1,3-diphenyl-2H-imidazole (CID 126693775) is 2,4,5-trimethyl-1,3-diphenyl-2H-imidazole.
What is the SMILES notation for 2,4,5-trimethyl-1,3-diphenyl-2H-imidazole?
The canonical SMILES for 2,4,5-trimethyl-1,3-diphenyl-2H-imidazole is CC1=C(C)N(c2ccccc2)C(C)N1c1ccccc1.
What is the InChIKey of 2,4,5-trimethyl-1,3-diphenyl-2H-imidazole?
The InChIKey is LMPQCAMGYFLPFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2/c1-14-15(2)20(18-12-8-5-9-13-18)16(3)19(14)17-10-6-4-7-11-17/h4-13,16H,1-3H3.
What are the key properties of 2,4,5-trimethyl-1,3-diphenyl-2H-imidazole?
2,4,5-trimethyl-1,3-diphenyl-2H-imidazole has a molecular weight of 264.37 g/mol, XLogP of 4.61, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,5-trimethyl-1,3-diphenyl-2H-imidazole is sourced from PubChem (CID 126693775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).