C23H37ClN4OS — CID 126694034
5-chloro-2-[4-[2-[2-[(1-propan-2-ylsulfanylpiperidin-4-yl)methoxy]ethyl]cyclopropyl]piperidin-1-yl]pyrimidine (PubChem CID 126694034) has the molecular formula C23H37ClN4OS and a molecular weight of 453.10 g/mol. Its IUPAC name is 5-chloro-2-[4-[2-[2-[(1-propan-2-ylsulfanylpiperidin-4-yl)methoxy]ethyl]cyclopropyl]piperidin-1-yl]pyrimidine.
| Compound Name | 5-chloro-2-[4-[2-[2-[(1-propan-2-ylsulfanylpiperidin-4-yl)methoxy]ethyl]cyclopropyl]piperidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 126694034 |
| Molecular Formula | C23H37ClN4OS |
| Molecular Weight | 453.10 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | 5-chloro-2-[4-[2-[2-[(1-propan-2-ylsulfanylpiperidin-4-yl)methoxy]ethyl]cyclopropyl]piperidin-1-yl]pyrimidine |
| SMILES | CC(C)SN1CCC(COCCC2CC2C2CCN(c3ncc(Cl)cn3)CC2)CC1 |
| InChI | InChI=1S/C23H37ClN4OS/c1-17(2)30-28-10-3-18(4-11-28)16-29-12-7-20-13-22(20)19-5-8-27(9-6-19)23-25-14-21(24)15-26-23/h14-15,17-20,22H,3-13,16H2,1-2H3 |
| InChIKey | YVFHAJHESCISSI-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.10 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|