C23H34ClF3N4OS — CID 126694331
5-chloro-2-[4-[2-[2-[[1-(3,3,3-trifluoropropylsulfanyl)piperidin-4-yl]methoxy]ethyl]cyclopropyl]piperidin-1-yl]pyrimidine (PubChem CID 126694331) has the molecular formula C23H34ClF3N4OS and a molecular weight of 507.07 g/mol. Its IUPAC name is 5-chloro-2-[4-[2-[2-[[1-(3,3,3-trifluoropropylsulfanyl)piperidin-4-yl]methoxy]ethyl]cyclopropyl]piperidin-1-yl]pyrimidine.
| Compound Name | 5-chloro-2-[4-[2-[2-[[1-(3,3,3-trifluoropropylsulfanyl)piperidin-4-yl]methoxy]ethyl]cyclopropyl]piperidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 126694331 |
| Molecular Formula | C23H34ClF3N4OS |
| Molecular Weight | 507.07 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | 5-chloro-2-[4-[2-[2-[[1-(3,3,3-trifluoropropylsulfanyl)piperidin-4-yl]methoxy]ethyl]cyclopropyl]piperidin-1-yl]pyrimidine |
| SMILES | FC(F)(F)CCSN1CCC(COCCC2CC2C2CCN(c3ncc(Cl)cn3)CC2)CC1 |
| InChI | InChI=1S/C23H34ClF3N4OS/c24-20-14-28-22(29-15-20)30-7-3-18(4-8-30)21-13-19(21)5-11-32-16-17-1-9-31(10-2-17)33-12-6-23(25,26)27/h14-15,17-19,21H,1-13,16H2 |
| InChIKey | JBOLBOWGBONJFJ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.07 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|