C48H40N4O6 — CID 126694462
3,7-bis[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]-2,6-dihydro-2,6-naphthyridine-1,5-dione (PubChem CID 126694462) has the molecular formula C48H40N4O6 and a molecular weight of 768.87 g/mol. Its IUPAC name is 3,7-bis[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]-2,6-dihydro-2,6-naphthyridine-1,5-dione.
| Compound Name | 3,7-bis[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]-2,6-dihydro-2,6-naphthyridine-1,5-dione |
|---|---|
| PubChem CID | 126694462 |
| Molecular Formula | C48H40N4O6 |
| Molecular Weight | 768.87 g/mol |
| Exact Mass | 768.29 |
| IUPAC Name | 3,7-bis[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]-2,6-dihydro-2,6-naphthyridine-1,5-dione |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2ccc(-c3cc4c(=O)[nH]c(-c5ccc(N(c6ccc(OC)cc6)c6ccc(OC)cc6)cc5)cc4c(=O)[nH]3)cc2)cc1 |
| InChI | InChI=1S/C48H40N4O6/c1-55-39-21-13-35(14-22-39)51(36-15-23-40(56-2)24-16-36)33-9-5-31(6-10-33)45-29-43-44(47(53)49-45)30-46(50-48(43)54)32-7-11-34(12-8-32)52(37-17-25-41(57-3)26-18-37)38-19-27-42(58-4)28-20-38/h5-30H,1-4H3,(H,49,53)(H,50,54) |
| InChIKey | RVNITUHULNMGHP-UHFFFAOYSA-N |
| XLogP | 10.52 |
| TPSA | 109.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.87 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |