About N-ethenyl-4,6-dimethyl-1,4-dihydropyrimidin-2-amine
N-ethenyl-4,6-dimethyl-1,4-dihydropyrimidin-2-amine (PubChem CID 126694644) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is N-ethenyl-4,6-dimethyl-1,4-dihydropyrimidin-2-amine.
Molecular Properties
| Compound Name | N-ethenyl-4,6-dimethyl-1,4-dihydropyrimidin-2-amine |
| PubChem CID | 126694644 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | N-ethenyl-4,6-dimethyl-1,4-dihydropyrimidin-2-amine |
| SMILES | C=CNC1=NC(C)C=C(C)N1 |
| InChI | InChI=1S/C8H13N3/c1-4-9-8-10-6(2)5-7(3)11-8/h4-6H,1H2,2-3H3,(H2,9,10,11) |
| InChIKey | ONWIDWZGVXNYMZ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethenyl-4,6-dimethyl-1,4-dihydropyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenyl-4,6-dimethyl-1,4-dihydropyrimidin-2-amine?
The IUPAC name of N-ethenyl-4,6-dimethyl-1,4-dihydropyrimidin-2-amine (CID 126694644) is N-ethenyl-4,6-dimethyl-1,4-dihydropyrimidin-2-amine.
What is the SMILES notation for N-ethenyl-4,6-dimethyl-1,4-dihydropyrimidin-2-amine?
The canonical SMILES for N-ethenyl-4,6-dimethyl-1,4-dihydropyrimidin-2-amine is C=CNC1=NC(C)C=C(C)N1.
What is the InChIKey of N-ethenyl-4,6-dimethyl-1,4-dihydropyrimidin-2-amine?
The InChIKey is ONWIDWZGVXNYMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3/c1-4-9-8-10-6(2)5-7(3)11-8/h4-6H,1H2,2-3H3,(H2,9,10,11).
What are the key properties of N-ethenyl-4,6-dimethyl-1,4-dihydropyrimidin-2-amine?
N-ethenyl-4,6-dimethyl-1,4-dihydropyrimidin-2-amine has a molecular weight of 151.21 g/mol, XLogP of 0.97, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenyl-4,6-dimethyl-1,4-dihydropyrimidin-2-amine is sourced from PubChem (CID 126694644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).