About 2,4,5-trimethyl-1,3-di(propan-2-yl)-2H-imidazole
2,4,5-trimethyl-1,3-di(propan-2-yl)-2H-imidazole (PubChem CID 126695152) has the molecular formula C12H24N2
and a molecular weight of 196.34 g/mol. Its IUPAC name is 2,4,5-trimethyl-1,3-di(propan-2-yl)-2H-imidazole.
Molecular Properties
| Compound Name | 2,4,5-trimethyl-1,3-di(propan-2-yl)-2H-imidazole |
| PubChem CID | 126695152 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 2,4,5-trimethyl-1,3-di(propan-2-yl)-2H-imidazole |
| SMILES | CC1=C(C)N(C(C)C)C(C)N1C(C)C |
| InChI | InChI=1S/C12H24N2/c1-8(2)13-10(5)11(6)14(9(3)4)12(13)7/h8-9,12H,1-7H3 |
| InChIKey | NWIZXIOYOCILSG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4,5-trimethyl-1,3-di(propan-2-yl)-2H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,5-trimethyl-1,3-di(propan-2-yl)-2H-imidazole?
The IUPAC name of 2,4,5-trimethyl-1,3-di(propan-2-yl)-2H-imidazole (CID 126695152) is 2,4,5-trimethyl-1,3-di(propan-2-yl)-2H-imidazole.
What is the SMILES notation for 2,4,5-trimethyl-1,3-di(propan-2-yl)-2H-imidazole?
The canonical SMILES for 2,4,5-trimethyl-1,3-di(propan-2-yl)-2H-imidazole is CC1=C(C)N(C(C)C)C(C)N1C(C)C.
What is the InChIKey of 2,4,5-trimethyl-1,3-di(propan-2-yl)-2H-imidazole?
The InChIKey is NWIZXIOYOCILSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2/c1-8(2)13-10(5)11(6)14(9(3)4)12(13)7/h8-9,12H,1-7H3.
What are the key properties of 2,4,5-trimethyl-1,3-di(propan-2-yl)-2H-imidazole?
2,4,5-trimethyl-1,3-di(propan-2-yl)-2H-imidazole has a molecular weight of 196.34 g/mol, XLogP of 3.02, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,5-trimethyl-1,3-di(propan-2-yl)-2H-imidazole is sourced from PubChem (CID 126695152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).