C11H16F3N — CID 126695394
(3Z,5E,7Z)-2-methyl-6-(trifluoromethyl)nona-3,5,7-trien-3-amine (PubChem CID 126695394) has the molecular formula C11H16F3N and a molecular weight of 219.25 g/mol. Its IUPAC name is (3Z,5E,7Z)-2-methyl-6-(trifluoromethyl)nona-3,5,7-trien-3-amine.
| Compound Name | (3Z,5E,7Z)-2-methyl-6-(trifluoromethyl)nona-3,5,7-trien-3-amine |
|---|---|
| PubChem CID | 126695394 |
| Molecular Formula | C11H16F3N |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | (3Z,5E,7Z)-2-methyl-6-(trifluoromethyl)nona-3,5,7-trien-3-amine |
| SMILES | C/C=C\C(=C/C=C(\N)C(C)C)C(F)(F)F |
| InChI | InChI=1S/C11H16F3N/c1-4-5-9(11(12,13)14)6-7-10(15)8(2)3/h4-8H,15H2,1-3H3/b5-4-,9-6+,10-7- |
| InChIKey | HVEKOJFORFMBMX-NRUPWVMRSA-N |
| XLogP | 3.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|