C22H26O6 — CID 126695398
(1R,8R,9R,10S)-10-methyl-8-prop-2-enyl-9-(3,4,5-trimethoxyphenyl)-2,4-dioxatricyclo[6.2.1.01,5]undec-5-en-7-one (PubChem CID 126695398) has the molecular formula C22H26O6 and a molecular weight of 386.44 g/mol. Its IUPAC name is (1R,8R,9R,10S)-10-methyl-8-prop-2-enyl-9-(3,4,5-trimethoxyphenyl)-2,4-dioxatricyclo[6.2.1.01,5]undec-5-en-7-one.
| Compound Name | (1R,8R,9R,10S)-10-methyl-8-prop-2-enyl-9-(3,4,5-trimethoxyphenyl)-2,4-dioxatricyclo[6.2.1.01,5]undec-5-en-7-one |
|---|---|
| PubChem CID | 126695398 |
| Molecular Formula | C22H26O6 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | (1R,8R,9R,10S)-10-methyl-8-prop-2-enyl-9-(3,4,5-trimethoxyphenyl)-2,4-dioxatricyclo[6.2.1.01,5]undec-5-en-7-one |
| SMILES | C=CC[C@]12C[C@@]3(OCOC3=CC1=O)[C@@H](C)[C@@H]2c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C22H26O6/c1-6-7-21-11-22(18(10-17(21)23)27-12-28-22)13(2)19(21)14-8-15(24-3)20(26-5)16(9-14)25-4/h6,8-10,13,19H,1,7,11-12H2,2-5H3/t13-,19+,21-,22+/m0/s1 |
| InChIKey | CQNGAOQBIJRCEA-LAOAPLBVSA-N |
| XLogP | 3.61 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|