C22H28O6 — CID 126695399
(6S,7aR)-6-prop-2-enyl-7a-[(2S)-1-(3,4,5-trimethoxyphenyl)propan-2-yl]-6,7-dihydro-1,3-benzodioxol-5-one (PubChem CID 126695399) has the molecular formula C22H28O6 and a molecular weight of 388.46 g/mol. Its IUPAC name is (6S,7aR)-6-prop-2-enyl-7a-[(2S)-1-(3,4,5-trimethoxyphenyl)propan-2-yl]-6,7-dihydro-1,3-benzodioxol-5-one.
| Compound Name | (6S,7aR)-6-prop-2-enyl-7a-[(2S)-1-(3,4,5-trimethoxyphenyl)propan-2-yl]-6,7-dihydro-1,3-benzodioxol-5-one |
|---|---|
| PubChem CID | 126695399 |
| Molecular Formula | C22H28O6 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | (6S,7aR)-6-prop-2-enyl-7a-[(2S)-1-(3,4,5-trimethoxyphenyl)propan-2-yl]-6,7-dihydro-1,3-benzodioxol-5-one |
| SMILES | C=CC[C@H]1C[C@]2([C@@H](C)Cc3cc(OC)c(OC)c(OC)c3)OCOC2=CC1=O |
| InChI | InChI=1S/C22H28O6/c1-6-7-16-12-22(20(11-17(16)23)27-13-28-22)14(2)8-15-9-18(24-3)21(26-5)19(10-15)25-4/h6,9-11,14,16H,1,7-8,12-13H2,2-5H3/t14-,16-,22+/m0/s1 |
| InChIKey | FBYNYXZXGPLZEG-KHJUTWJGSA-N |
| XLogP | 3.68 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|