About 5-methyl-2-naphthalen-2-yl-4-propyl-5,6-dihydro-4H-1,3-oxazine
5-methyl-2-naphthalen-2-yl-4-propyl-5,6-dihydro-4H-1,3-oxazine (PubChem CID 126695518) has the molecular formula C18H21NO
and a molecular weight of 267.37 g/mol. Its IUPAC name is 5-methyl-2-naphthalen-2-yl-4-propyl-5,6-dihydro-4H-1,3-oxazine.
Molecular Properties
| Compound Name | 5-methyl-2-naphthalen-2-yl-4-propyl-5,6-dihydro-4H-1,3-oxazine |
| PubChem CID | 126695518 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 5-methyl-2-naphthalen-2-yl-4-propyl-5,6-dihydro-4H-1,3-oxazine |
| SMILES | CCCC1N=C(c2ccc3ccccc3c2)OCC1C |
| InChI | InChI=1S/C18H21NO/c1-3-6-17-13(2)12-20-18(19-17)16-10-9-14-7-4-5-8-15(14)11-16/h4-5,7-11,13,17H,3,6,12H2,1-2H3 |
| InChIKey | IFYQTIDPINKNOK-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-2-naphthalen-2-yl-4-propyl-5,6-dihydro-4H-1,3-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-naphthalen-2-yl-4-propyl-5,6-dihydro-4H-1,3-oxazine?
The IUPAC name of 5-methyl-2-naphthalen-2-yl-4-propyl-5,6-dihydro-4H-1,3-oxazine (CID 126695518) is 5-methyl-2-naphthalen-2-yl-4-propyl-5,6-dihydro-4H-1,3-oxazine.
What is the SMILES notation for 5-methyl-2-naphthalen-2-yl-4-propyl-5,6-dihydro-4H-1,3-oxazine?
The canonical SMILES for 5-methyl-2-naphthalen-2-yl-4-propyl-5,6-dihydro-4H-1,3-oxazine is CCCC1N=C(c2ccc3ccccc3c2)OCC1C.
What is the InChIKey of 5-methyl-2-naphthalen-2-yl-4-propyl-5,6-dihydro-4H-1,3-oxazine?
The InChIKey is IFYQTIDPINKNOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO/c1-3-6-17-13(2)12-20-18(19-17)16-10-9-14-7-4-5-8-15(14)11-16/h4-5,7-11,13,17H,3,6,12H2,1-2H3.
What are the key properties of 5-methyl-2-naphthalen-2-yl-4-propyl-5,6-dihydro-4H-1,3-oxazine?
5-methyl-2-naphthalen-2-yl-4-propyl-5,6-dihydro-4H-1,3-oxazine has a molecular weight of 267.37 g/mol, XLogP of 4.42, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-naphthalen-2-yl-4-propyl-5,6-dihydro-4H-1,3-oxazine is sourced from PubChem (CID 126695518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).