C12H21NO3 — CID 126695521
(3E,5E)-2-ethyl-4,5-dimethoxy-N-methylhepta-3,5-dienamide (PubChem CID 126695521) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is (3E,5E)-2-ethyl-4,5-dimethoxy-N-methylhepta-3,5-dienamide.
| Compound Name | (3E,5E)-2-ethyl-4,5-dimethoxy-N-methylhepta-3,5-dienamide |
|---|---|
| PubChem CID | 126695521 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | (3E,5E)-2-ethyl-4,5-dimethoxy-N-methylhepta-3,5-dienamide |
| SMILES | C/C=C(OC)\C(=C/C(CC)C(=O)NC)OC |
| InChI | InChI=1S/C12H21NO3/c1-6-9(12(14)13-3)8-11(16-5)10(7-2)15-4/h7-9H,6H2,1-5H3,(H,13,14)/b10-7+,11-8+ |
| InChIKey | BZNPGZUSADPGDI-AMMQDNIMSA-N |
| XLogP | 1.84 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|