C11H14N2 — CID 12669576
2-butylpyrazolo[1,5-a]pyridine (PubChem CID 12669576) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 2-butylpyrazolo[1,5-a]pyridine.
| Compound Name | 2-butylpyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 12669576 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 2-butylpyrazolo[1,5-a]pyridine |
| SMILES | CCCCc1cc2ccccn2n1 |
| InChI | InChI=1S/C11H14N2/c1-2-3-6-10-9-11-7-4-5-8-13(11)12-10/h4-5,7-9H,2-3,6H2,1H3 |
| InChIKey | QCLBIZFKPWEZFW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |