C20H31N — CID 126695780
2,3,5-trimethyl-4-[(2Z,7Z)-6-methylidenenona-2,7-dien-3-yl]-2-propylpyrrole (PubChem CID 126695780) has the molecular formula C20H31N and a molecular weight of 285.47 g/mol. Its IUPAC name is 2,3,5-trimethyl-4-[(2Z,7Z)-6-methylidenenona-2,7-dien-3-yl]-2-propylpyrrole.
| Compound Name | 2,3,5-trimethyl-4-[(2Z,7Z)-6-methylidenenona-2,7-dien-3-yl]-2-propylpyrrole |
|---|---|
| PubChem CID | 126695780 |
| Molecular Formula | C20H31N |
| Molecular Weight | 285.47 g/mol |
| Exact Mass | 285.25 |
| IUPAC Name | 2,3,5-trimethyl-4-[(2Z,7Z)-6-methylidenenona-2,7-dien-3-yl]-2-propylpyrrole |
| SMILES | C=C(/C=C\C)CC/C(=C/C)C1=C(C)C(C)(CCC)N=C1C |
| InChI | InChI=1S/C20H31N/c1-8-11-15(4)12-13-18(10-3)19-16(5)20(7,14-9-2)21-17(19)6/h8,10-11H,4,9,12-14H2,1-3,5-7H3/b11-8-,18-10- |
| InChIKey | XOGXORVQHWMMIB-AXAHEQRBSA-N |
| XLogP | 6.20 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.47 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|