About 4-fluorobenzenesulfinyl chloride
4-fluorobenzenesulfinyl chloride (PubChem CID 12669616) has the molecular formula C6H4ClFOS
and a molecular weight of 178.62 g/mol. Its IUPAC name is 4-fluorobenzenesulfinyl chloride.
Molecular Properties
| Compound Name | 4-fluorobenzenesulfinyl chloride |
| PubChem CID | 12669616 |
| Molecular Formula | C6H4ClFOS |
| Molecular Weight | 178.62 g/mol |
| Exact Mass | 177.97 |
| IUPAC Name | 4-fluorobenzenesulfinyl chloride |
| SMILES | O=S(Cl)c1ccc(F)cc1 |
| InChI | InChI=1S/C6H4ClFOS/c7-10(9)6-3-1-5(8)2-4-6/h1-4H |
| InChIKey | BJWMYGBNKQPQLX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.62 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-fluorobenzenesulfinyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluorobenzenesulfinyl chloride?
The IUPAC name of 4-fluorobenzenesulfinyl chloride (CID 12669616) is 4-fluorobenzenesulfinyl chloride.
What is the SMILES notation for 4-fluorobenzenesulfinyl chloride?
The canonical SMILES for 4-fluorobenzenesulfinyl chloride is O=S(Cl)c1ccc(F)cc1.
What is the InChIKey of 4-fluorobenzenesulfinyl chloride?
The InChIKey is BJWMYGBNKQPQLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClFOS/c7-10(9)6-3-1-5(8)2-4-6/h1-4H.
What are the key properties of 4-fluorobenzenesulfinyl chloride?
4-fluorobenzenesulfinyl chloride has a molecular weight of 178.62 g/mol, XLogP of 2.09, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluorobenzenesulfinyl chloride is sourced from PubChem (CID 12669616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).