About (2-pyrazol-1-yl-1,3-thiazol-5-yl)methanamine;hydrochloride
(2-pyrazol-1-yl-1,3-thiazol-5-yl)methanamine;hydrochloride (PubChem CID 126697411) has the molecular formula C7H9ClN4S
and a molecular weight of 216.70 g/mol. Its IUPAC name is (2-pyrazol-1-yl-1,3-thiazol-5-yl)methanamine;hydrochloride.
Molecular Properties
| Compound Name | (2-pyrazol-1-yl-1,3-thiazol-5-yl)methanamine;hydrochloride |
| PubChem CID | 126697411 |
| Molecular Formula | C7H9ClN4S |
| Molecular Weight | 216.70 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | (2-pyrazol-1-yl-1,3-thiazol-5-yl)methanamine;hydrochloride |
| SMILES | Cl.NCc1cnc(-n2cccn2)s1 |
| InChI | InChI=1S/C7H8N4S.ClH/c8-4-6-5-9-7(12-6)11-3-1-2-10-11;/h1-3,5H,4,8H2;1H |
| InChIKey | WMWKYHLIQUGRQI-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.70 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-pyrazol-1-yl-1,3-thiazol-5-yl)methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-pyrazol-1-yl-1,3-thiazol-5-yl)methanamine;hydrochloride?
The IUPAC name of (2-pyrazol-1-yl-1,3-thiazol-5-yl)methanamine;hydrochloride (CID 126697411) is (2-pyrazol-1-yl-1,3-thiazol-5-yl)methanamine;hydrochloride.
What is the SMILES notation for (2-pyrazol-1-yl-1,3-thiazol-5-yl)methanamine;hydrochloride?
The canonical SMILES for (2-pyrazol-1-yl-1,3-thiazol-5-yl)methanamine;hydrochloride is Cl.NCc1cnc(-n2cccn2)s1.
What is the InChIKey of (2-pyrazol-1-yl-1,3-thiazol-5-yl)methanamine;hydrochloride?
The InChIKey is WMWKYHLIQUGRQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4S.ClH/c8-4-6-5-9-7(12-6)11-3-1-2-10-11;/h1-3,5H,4,8H2;1H.
What are the key properties of (2-pyrazol-1-yl-1,3-thiazol-5-yl)methanamine;hydrochloride?
(2-pyrazol-1-yl-1,3-thiazol-5-yl)methanamine;hydrochloride has a molecular weight of 216.70 g/mol, XLogP of 1.21, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-pyrazol-1-yl-1,3-thiazol-5-yl)methanamine;hydrochloride is sourced from PubChem (CID 126697411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).