About [2-[2-(dimethylamino)ethylsulfanyl]-1,3-thiazol-5-yl]methyl carbamate
[2-[2-(dimethylamino)ethylsulfanyl]-1,3-thiazol-5-yl]methyl carbamate (PubChem CID 126697424) has the molecular formula C9H15N3O2S2
and a molecular weight of 261.37 g/mol. Its IUPAC name is [2-[2-(dimethylamino)ethylsulfanyl]-1,3-thiazol-5-yl]methyl carbamate.
Molecular Properties
| Compound Name | [2-[2-(dimethylamino)ethylsulfanyl]-1,3-thiazol-5-yl]methyl carbamate |
| PubChem CID | 126697424 |
| Molecular Formula | C9H15N3O2S2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | [2-[2-(dimethylamino)ethylsulfanyl]-1,3-thiazol-5-yl]methyl carbamate |
| SMILES | CN(C)CCSc1ncc(COC(N)=O)s1 |
| InChI | InChI=1S/C9H15N3O2S2/c1-12(2)3-4-15-9-11-5-7(16-9)6-14-8(10)13/h5H,3-4,6H2,1-2H3,(H2,10,13) |
| InChIKey | PEGDEWPDUBNJAQ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|
Analyze [2-[2-(dimethylamino)ethylsulfanyl]-1,3-thiazol-5-yl]methyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[2-(dimethylamino)ethylsulfanyl]-1,3-thiazol-5-yl]methyl carbamate?
The IUPAC name of [2-[2-(dimethylamino)ethylsulfanyl]-1,3-thiazol-5-yl]methyl carbamate (CID 126697424) is [2-[2-(dimethylamino)ethylsulfanyl]-1,3-thiazol-5-yl]methyl carbamate.
What is the SMILES notation for [2-[2-(dimethylamino)ethylsulfanyl]-1,3-thiazol-5-yl]methyl carbamate?
The canonical SMILES for [2-[2-(dimethylamino)ethylsulfanyl]-1,3-thiazol-5-yl]methyl carbamate is CN(C)CCSc1ncc(COC(N)=O)s1.
What is the InChIKey of [2-[2-(dimethylamino)ethylsulfanyl]-1,3-thiazol-5-yl]methyl carbamate?
The InChIKey is PEGDEWPDUBNJAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O2S2/c1-12(2)3-4-15-9-11-5-7(16-9)6-14-8(10)13/h5H,3-4,6H2,1-2H3,(H2,10,13).
What are the key properties of [2-[2-(dimethylamino)ethylsulfanyl]-1,3-thiazol-5-yl]methyl carbamate?
[2-[2-(dimethylamino)ethylsulfanyl]-1,3-thiazol-5-yl]methyl carbamate has a molecular weight of 261.37 g/mol, XLogP of 1.39, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[2-(dimethylamino)ethylsulfanyl]-1,3-thiazol-5-yl]methyl carbamate is sourced from PubChem (CID 126697424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).