C25H27N3O9 — CID 126697663
methyl 4-[2-[(3aS,4S,7R,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]ethyl-[2-[(4R,7S,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]ethyl]amino]-4-oxobutanoate (PubChem CID 126697663) has the molecular formula C25H27N3O9 and a molecular weight of 513.50 g/mol. Its IUPAC name is methyl 4-[2-[(3aS,4S,7R,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]ethyl-[2-[(4R,7S,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]ethyl]amino]-4-oxobutanoate.
| Compound Name | methyl 4-[2-[(3aS,4S,7R,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]ethyl-[2-[(4R,7S,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]ethyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 126697663 |
| Molecular Formula | C25H27N3O9 |
| Molecular Weight | 513.50 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | methyl 4-[2-[(3aS,4S,7R,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]ethyl-[2-[(4R,7S,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]ethyl]amino]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)N(CCN1C(=O)[C@@H]2[C@H](C1=O)[C@@H]1C=C[C@H]2O1)CCN1C(=O)C2[C@H]3C=C[C@H](O3)[C@H]2C1=O |
| InChI | InChI=1S/C25H27N3O9/c1-35-17(30)7-6-16(29)26(8-10-27-22(31)18-12-2-3-13(36-12)19(18)23(27)32)9-11-28-24(33)20-14-4-5-15(37-14)21(20)25(28)34/h2-5,12-15,18-21H,6-11H2,1H3/t12-,13+,14-,15+,18+,19-,20+,21?/m0/s1 |
| InChIKey | SIGUJOARLJDNOD-CPDBMIKDSA-N |
| XLogP | -1.36 |
| TPSA | 139.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.50 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|