C25H24FN7O — CID 126697778
2-[4-(4-amino-2,7-dimethylpyrrolo[2,3-d]pyrimidin-5-yl)-3-fluorophenyl]-4-[(2,5-dimethylphenyl)methyl]-1,2,4-triazol-3-one (PubChem CID 126697778) has the molecular formula C25H24FN7O and a molecular weight of 457.51 g/mol. Its IUPAC name is 2-[4-(4-amino-2,7-dimethylpyrrolo[2,3-d]pyrimidin-5-yl)-3-fluorophenyl]-4-[(2,5-dimethylphenyl)methyl]-1,2,4-triazol-3-one.
| Compound Name | 2-[4-(4-amino-2,7-dimethylpyrrolo[2,3-d]pyrimidin-5-yl)-3-fluorophenyl]-4-[(2,5-dimethylphenyl)methyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 126697778 |
| Molecular Formula | C25H24FN7O |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 2-[4-(4-amino-2,7-dimethylpyrrolo[2,3-d]pyrimidin-5-yl)-3-fluorophenyl]-4-[(2,5-dimethylphenyl)methyl]-1,2,4-triazol-3-one |
| SMILES | Cc1ccc(C)c(Cn2cnn(-c3ccc(-c4cn(C)c5nc(C)nc(N)c45)c(F)c3)c2=O)c1 |
| InChI | InChI=1S/C25H24FN7O/c1-14-5-6-15(2)17(9-14)11-32-13-28-33(25(32)34)18-7-8-19(21(26)10-18)20-12-31(4)24-22(20)23(27)29-16(3)30-24/h5-10,12-13H,11H2,1-4H3,(H2,27,29,30) |
| InChIKey | DOMGYXHNSKEGFW-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 96.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |