About [(1S)-5-methyl-2-propan-2-ylcyclohexyl] bicyclo[2.2.1]hepta-2,5-diene-2-carboxylate
[(1S)-5-methyl-2-propan-2-ylcyclohexyl] bicyclo[2.2.1]hepta-2,5-diene-2-carboxylate (PubChem CID 126698232) has the molecular formula C18H26O2
and a molecular weight of 274.40 g/mol. Its IUPAC name is [(1S)-5-methyl-2-propan-2-ylcyclohexyl] bicyclo[2.2.1]hepta-2,5-diene-2-carboxylate.
Molecular Properties
| Compound Name | [(1S)-5-methyl-2-propan-2-ylcyclohexyl] bicyclo[2.2.1]hepta-2,5-diene-2-carboxylate |
| PubChem CID | 126698232 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | [(1S)-5-methyl-2-propan-2-ylcyclohexyl] bicyclo[2.2.1]hepta-2,5-diene-2-carboxylate |
| SMILES | CC1CCC(C(C)C)[C@@H](OC(=O)C2=CC3C=CC2C3)C1 |
| InChI | InChI=1S/C18H26O2/c1-11(2)15-7-4-12(3)8-17(15)20-18(19)16-10-13-5-6-14(16)9-13/h5-6,10-15,17H,4,7-9H2,1-3H3/t12?,13?,14?,15?,17-/m0/s1 |
| InChIKey | PYWGHIXJDFITDY-SYRUZEPSSA-N |
| XLogP | 4.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-5-methyl-2-propan-2-ylcyclohexyl] bicyclo[2.2.1]hepta-2,5-diene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-5-methyl-2-propan-2-ylcyclohexyl] bicyclo[2.2.1]hepta-2,5-diene-2-carboxylate?
The IUPAC name of [(1S)-5-methyl-2-propan-2-ylcyclohexyl] bicyclo[2.2.1]hepta-2,5-diene-2-carboxylate (CID 126698232) is [(1S)-5-methyl-2-propan-2-ylcyclohexyl] bicyclo[2.2.1]hepta-2,5-diene-2-carboxylate.
What is the SMILES notation for [(1S)-5-methyl-2-propan-2-ylcyclohexyl] bicyclo[2.2.1]hepta-2,5-diene-2-carboxylate?
The canonical SMILES for [(1S)-5-methyl-2-propan-2-ylcyclohexyl] bicyclo[2.2.1]hepta-2,5-diene-2-carboxylate is CC1CCC(C(C)C)[C@@H](OC(=O)C2=CC3C=CC2C3)C1.
What is the InChIKey of [(1S)-5-methyl-2-propan-2-ylcyclohexyl] bicyclo[2.2.1]hepta-2,5-diene-2-carboxylate?
The InChIKey is PYWGHIXJDFITDY-SYRUZEPSSA-N. The full InChI is InChI=1S/C18H26O2/c1-11(2)15-7-4-12(3)8-17(15)20-18(19)16-10-13-5-6-14(16)9-13/h5-6,10-15,17H,4,7-9H2,1-3H3/t12?,13?,14?,15?,17-/m0/s1.
What are the key properties of [(1S)-5-methyl-2-propan-2-ylcyclohexyl] bicyclo[2.2.1]hepta-2,5-diene-2-carboxylate?
[(1S)-5-methyl-2-propan-2-ylcyclohexyl] bicyclo[2.2.1]hepta-2,5-diene-2-carboxylate has a molecular weight of 274.40 g/mol, XLogP of 4.12, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-5-methyl-2-propan-2-ylcyclohexyl] bicyclo[2.2.1]hepta-2,5-diene-2-carboxylate is sourced from PubChem (CID 126698232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).