C21H27NO — CID 126698302
(4Z,5Z)-4-butan-2-ylidene-7-ethyl-1-[(1E,3Z)-hexa-1,3,5-trienyl]-5-prop-2-enylidene-2H-azepin-3-one (PubChem CID 126698302) has the molecular formula C21H27NO and a molecular weight of 309.45 g/mol. Its IUPAC name is (4Z,5Z)-4-butan-2-ylidene-7-ethyl-1-[(1E,3Z)-hexa-1,3,5-trienyl]-5-prop-2-enylidene-2H-azepin-3-one.
| Compound Name | (4Z,5Z)-4-butan-2-ylidene-7-ethyl-1-[(1E,3Z)-hexa-1,3,5-trienyl]-5-prop-2-enylidene-2H-azepin-3-one |
|---|---|
| PubChem CID | 126698302 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | (4Z,5Z)-4-butan-2-ylidene-7-ethyl-1-[(1E,3Z)-hexa-1,3,5-trienyl]-5-prop-2-enylidene-2H-azepin-3-one |
| SMILES | C=C/C=C\C=C\N1CC(=O)C(=C(/C)CC)/C(=C\C=C)C=C1CC |
| InChI | InChI=1S/C21H27NO/c1-6-10-11-12-14-22-16-20(23)21(17(5)8-3)18(13-7-2)15-19(22)9-4/h6-7,10-15H,1-2,8-9,16H2,3-5H3/b11-10-,14-12+,18-13-,21-17- |
| InChIKey | OOUCFHLOGQTAFJ-YGEDKPKXSA-N |
| XLogP | 5.26 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|