C32H25N5O3S — CID 126698425
N-[3-[(E)-3-[(1S,13S)-3,13-dimethyl-7-oxo-5-thia-10-azatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-trien-10-yl]-3-oxoprop-1-enyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-1H-indole-2-carboxamide (PubChem CID 126698425) has the molecular formula C32H25N5O3S and a molecular weight of 559.65 g/mol. Its IUPAC name is N-[3-[(E)-3-[(1S,13S)-3,13-dimethyl-7-oxo-5-thia-10-azatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-trien-10-yl]-3-oxoprop-1-enyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-1H-indole-2-carboxamide.
| Compound Name | N-[3-[(E)-3-[(1S,13S)-3,13-dimethyl-7-oxo-5-thia-10-azatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-trien-10-yl]-3-oxoprop-1-enyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 126698425 |
| Molecular Formula | C32H25N5O3S |
| Molecular Weight | 559.65 g/mol |
| Exact Mass | 559.17 |
| IUPAC Name | N-[3-[(E)-3-[(1S,13S)-3,13-dimethyl-7-oxo-5-thia-10-azatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-trien-10-yl]-3-oxoprop-1-enyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-1H-indole-2-carboxamide |
| SMILES | Cc1csc2c1[C@@]13C(=CC2=O)N(C(=O)/C=C/c2c[nH]c4ncc(NC(=O)c5cc6ccccc6[nH]5)cc24)CC1[C@@H]3C |
| InChI | InChI=1S/C32H25N5O3S/c1-16-15-41-29-25(38)11-26-32(28(16)29)17(2)22(32)14-37(26)27(39)8-7-19-12-33-30-21(19)10-20(13-34-30)35-31(40)24-9-18-5-3-4-6-23(18)36-24/h3-13,15,17,22,36H,14H2,1-2H3,(H,33,34)(H,35,40)/b8-7+/t17-,22?,32+/m0/s1 |
| InChIKey | JHHUSTBXOTYVFE-LOXYFLDUSA-N |
| XLogP | 5.81 |
| TPSA | 110.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.65 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|