C15H14NO2+ — CID 126698526
7-[(1Z)-buta-1,3-dienyl]-1,8-dimethylquinolin-1-ium-5,6-dione (PubChem CID 126698526) has the molecular formula C15H14NO2+ and a molecular weight of 240.28 g/mol. Its IUPAC name is 7-[(1Z)-buta-1,3-dienyl]-1,8-dimethylquinolin-1-ium-5,6-dione.
| Compound Name | 7-[(1Z)-buta-1,3-dienyl]-1,8-dimethylquinolin-1-ium-5,6-dione |
|---|---|
| PubChem CID | 126698526 |
| Molecular Formula | C15H14NO2+ |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 7-[(1Z)-buta-1,3-dienyl]-1,8-dimethylquinolin-1-ium-5,6-dione |
| SMILES | C=C/C=C\C1=C(C)c2c(ccc[n+]2C)C(=O)C1=O |
| InChI | InChI=1S/C15H14NO2/c1-4-5-7-11-10(2)13-12(15(18)14(11)17)8-6-9-16(13)3/h4-9H,1H2,2-3H3/q+1/b7-5- |
| InChIKey | CHKKTTAJNJBHFY-ALCCZGGFSA-N |
| XLogP | 1.79 |
| TPSA | 38.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|