About 1,3-dibromo-1,3-dichloropropane
1,3-dibromo-1,3-dichloropropane (PubChem CID 12669923) has the molecular formula C3H4Br2Cl2
and a molecular weight of 270.78 g/mol. Its IUPAC name is 1,3-dibromo-1,3-dichloropropane.
Molecular Properties
| Compound Name | 1,3-dibromo-1,3-dichloropropane |
| PubChem CID | 12669923 |
| Molecular Formula | C3H4Br2Cl2 |
| Molecular Weight | 270.78 g/mol |
| Exact Mass | 267.81 |
| IUPAC Name | 1,3-dibromo-1,3-dichloropropane |
| SMILES | ClC(Br)CC(Cl)Br |
| InChI | InChI=1S/C3H4Br2Cl2/c4-2(6)1-3(5)7/h2-3H,1H2 |
| InChIKey | KWPNYDMATQDHFW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.78 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dibromo-1,3-dichloropropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dibromo-1,3-dichloropropane?
The IUPAC name of 1,3-dibromo-1,3-dichloropropane (CID 12669923) is 1,3-dibromo-1,3-dichloropropane.
What is the SMILES notation for 1,3-dibromo-1,3-dichloropropane?
The canonical SMILES for 1,3-dibromo-1,3-dichloropropane is ClC(Br)CC(Cl)Br.
What is the InChIKey of 1,3-dibromo-1,3-dichloropropane?
The InChIKey is KWPNYDMATQDHFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4Br2Cl2/c4-2(6)1-3(5)7/h2-3H,1H2.
What are the key properties of 1,3-dibromo-1,3-dichloropropane?
1,3-dibromo-1,3-dichloropropane has a molecular weight of 270.78 g/mol, XLogP of 3.30, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dibromo-1,3-dichloropropane is sourced from PubChem (CID 12669923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).