About 1,1,3,3-tetrabromopropane
1,1,3,3-tetrabromopropane (PubChem CID 12669924) has the molecular formula C3H4Br4
and a molecular weight of 359.68 g/mol. Its IUPAC name is 1,1,3,3-tetrabromopropane.
Molecular Properties
| Compound Name | 1,1,3,3-tetrabromopropane |
| PubChem CID | 12669924 |
| Molecular Formula | C3H4Br4 |
| Molecular Weight | 359.68 g/mol |
| Exact Mass | 355.70 |
| IUPAC Name | 1,1,3,3-tetrabromopropane |
| SMILES | BrC(Br)CC(Br)Br |
| InChI | InChI=1S/C3H4Br4/c4-2(5)1-3(6)7/h2-3H,1H2 |
| InChIKey | LPDCLVOAGHOVLT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.68 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,1,3,3-tetrabromopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,3,3-tetrabromopropane?
The IUPAC name of 1,1,3,3-tetrabromopropane (CID 12669924) is 1,1,3,3-tetrabromopropane.
What is the SMILES notation for 1,1,3,3-tetrabromopropane?
The canonical SMILES for 1,1,3,3-tetrabromopropane is BrC(Br)CC(Br)Br.
What is the InChIKey of 1,1,3,3-tetrabromopropane?
The InChIKey is LPDCLVOAGHOVLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4Br4/c4-2(5)1-3(6)7/h2-3H,1H2.
What are the key properties of 1,1,3,3-tetrabromopropane?
1,1,3,3-tetrabromopropane has a molecular weight of 359.68 g/mol, XLogP of 3.61, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,3,3-tetrabromopropane is sourced from PubChem (CID 12669924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).