About 2-(4-ethyl-3-fluorophenyl)-1'-(oxetan-3-yl)spiro[5H-furo[3,4-b]pyridine-7,4'-piperidine]
2-(4-ethyl-3-fluorophenyl)-1'-(oxetan-3-yl)spiro[5H-furo[3,4-b]pyridine-7,4'-piperidine] (PubChem CID 126699271) has the molecular formula C22H25FN2O2
and a molecular weight of 368.45 g/mol. Its IUPAC name is 2-(4-ethyl-3-fluorophenyl)-1'-(oxetan-3-yl)spiro[5H-furo[3,4-b]pyridine-7,4'-piperidine].
Molecular Properties
| Compound Name | 2-(4-ethyl-3-fluorophenyl)-1'-(oxetan-3-yl)spiro[5H-furo[3,4-b]pyridine-7,4'-piperidine] |
| PubChem CID | 126699271 |
| Molecular Formula | C22H25FN2O2 |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 2-(4-ethyl-3-fluorophenyl)-1'-(oxetan-3-yl)spiro[5H-furo[3,4-b]pyridine-7,4'-piperidine] |
| SMILES | CCc1ccc(-c2ccc3c(n2)C2(CCN(C4COC4)CC2)OC3)cc1F |
| InChI | InChI=1S/C22H25FN2O2/c1-2-15-3-4-16(11-19(15)23)20-6-5-17-12-27-22(21(17)24-20)7-9-25(10-8-22)18-13-26-14-18/h3-6,11,18H,2,7-10,12-14H2,1H3 |
| InChIKey | YGNVLUMWHYKHLB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-ethyl-3-fluorophenyl)-1'-(oxetan-3-yl)spiro[5H-furo[3,4-b]pyridine-7,4'-piperidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethyl-3-fluorophenyl)-1'-(oxetan-3-yl)spiro[5H-furo[3,4-b]pyridine-7,4'-piperidine]?
The IUPAC name of 2-(4-ethyl-3-fluorophenyl)-1'-(oxetan-3-yl)spiro[5H-furo[3,4-b]pyridine-7,4'-piperidine] (CID 126699271) is 2-(4-ethyl-3-fluorophenyl)-1'-(oxetan-3-yl)spiro[5H-furo[3,4-b]pyridine-7,4'-piperidine].
What is the SMILES notation for 2-(4-ethyl-3-fluorophenyl)-1'-(oxetan-3-yl)spiro[5H-furo[3,4-b]pyridine-7,4'-piperidine]?
The canonical SMILES for 2-(4-ethyl-3-fluorophenyl)-1'-(oxetan-3-yl)spiro[5H-furo[3,4-b]pyridine-7,4'-piperidine] is CCc1ccc(-c2ccc3c(n2)C2(CCN(C4COC4)CC2)OC3)cc1F.
What is the InChIKey of 2-(4-ethyl-3-fluorophenyl)-1'-(oxetan-3-yl)spiro[5H-furo[3,4-b]pyridine-7,4'-piperidine]?
The InChIKey is YGNVLUMWHYKHLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25FN2O2/c1-2-15-3-4-16(11-19(15)23)20-6-5-17-12-27-22(21(17)24-20)7-9-25(10-8-22)18-13-26-14-18/h3-6,11,18H,2,7-10,12-14H2,1H3.
What are the key properties of 2-(4-ethyl-3-fluorophenyl)-1'-(oxetan-3-yl)spiro[5H-furo[3,4-b]pyridine-7,4'-piperidine]?
2-(4-ethyl-3-fluorophenyl)-1'-(oxetan-3-yl)spiro[5H-furo[3,4-b]pyridine-7,4'-piperidine] has a molecular weight of 368.45 g/mol, XLogP of 3.67, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethyl-3-fluorophenyl)-1'-(oxetan-3-yl)spiro[5H-furo[3,4-b]pyridine-7,4'-piperidine] is sourced from PubChem (CID 126699271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).