C24H38N2O5 — CID 126699641
2-[2-[2-[(3-heptoxy-5,8-dimethylquinoxalin-2-yl)methoxy]ethoxy]ethoxy]ethanol (PubChem CID 126699641) has the molecular formula C24H38N2O5 and a molecular weight of 434.58 g/mol. Its IUPAC name is 2-[2-[2-[(3-heptoxy-5,8-dimethylquinoxalin-2-yl)methoxy]ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-[(3-heptoxy-5,8-dimethylquinoxalin-2-yl)methoxy]ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 126699641 |
| Molecular Formula | C24H38N2O5 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | 2-[2-[2-[(3-heptoxy-5,8-dimethylquinoxalin-2-yl)methoxy]ethoxy]ethoxy]ethanol |
| SMILES | CCCCCCCOc1nc2c(C)ccc(C)c2nc1COCCOCCOCCO |
| InChI | InChI=1S/C24H38N2O5/c1-4-5-6-7-8-12-31-24-21(18-30-17-16-29-15-14-28-13-11-27)25-22-19(2)9-10-20(3)23(22)26-24/h9-10,27H,4-8,11-18H2,1-3H3 |
| InChIKey | ZXPYPGGLJXKNRG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 82.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|