C12H17NO — CID 126700013
7,9-dimethyl-3,4,5,6-tetrahydro-2H-1,6-benzoxazocine (PubChem CID 126700013) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 7,9-dimethyl-3,4,5,6-tetrahydro-2H-1,6-benzoxazocine.
| Compound Name | 7,9-dimethyl-3,4,5,6-tetrahydro-2H-1,6-benzoxazocine |
|---|---|
| PubChem CID | 126700013 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 7,9-dimethyl-3,4,5,6-tetrahydro-2H-1,6-benzoxazocine |
| SMILES | Cc1cc(C)c2c(c1)OCCCCN2 |
| InChI | InChI=1S/C12H17NO/c1-9-7-10(2)12-11(8-9)14-6-4-3-5-13-12/h7-8,13H,3-6H2,1-2H3 |
| InChIKey | CENNKPVJOGNGEH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |