C20H22N2 — CID 126700323
(2S,7R)-5-methyl-1,5-diazapentacyclo[10.8.1.02,7.08,21.014,19]henicosa-8,10,12(21),14,16,18-hexaene (PubChem CID 126700323) has the molecular formula C20H22N2 and a molecular weight of 290.41 g/mol. Its IUPAC name is (2S,7R)-5-methyl-1,5-diazapentacyclo[10.8.1.02,7.08,21.014,19]henicosa-8,10,12(21),14,16,18-hexaene.
| Compound Name | (2S,7R)-5-methyl-1,5-diazapentacyclo[10.8.1.02,7.08,21.014,19]henicosa-8,10,12(21),14,16,18-hexaene |
|---|---|
| PubChem CID | 126700323 |
| Molecular Formula | C20H22N2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | (2S,7R)-5-methyl-1,5-diazapentacyclo[10.8.1.02,7.08,21.014,19]henicosa-8,10,12(21),14,16,18-hexaene |
| SMILES | CN1CC[C@H]2[C@@H](C1)c1cccc3c1N2Cc1ccccc1C3 |
| InChI | InChI=1S/C20H22N2/c1-21-10-9-19-18(13-21)17-8-4-7-15-11-14-5-2-3-6-16(14)12-22(19)20(15)17/h2-8,18-19H,9-13H2,1H3/t18-,19-/m0/s1 |
| InChIKey | NXULVFRKTLCQKU-OALUTQOASA-N |
| XLogP | 3.40 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |