C22H22FN5O3 — CID 126700683
5-[6-[[(1S)-2-amino-1-cyclopropyl-2-oxoethyl]amino]-9-oxa-1,3-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-2-yl]-2-fluorobenzamide (PubChem CID 126700683) has the molecular formula C22H22FN5O3 and a molecular weight of 423.45 g/mol. Its IUPAC name is 5-[6-[[(1S)-2-amino-1-cyclopropyl-2-oxoethyl]amino]-9-oxa-1,3-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-2-yl]-2-fluorobenzamide.
| Compound Name | 5-[6-[[(1S)-2-amino-1-cyclopropyl-2-oxoethyl]amino]-9-oxa-1,3-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-2-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 126700683 |
| Molecular Formula | C22H22FN5O3 |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 5-[6-[[(1S)-2-amino-1-cyclopropyl-2-oxoethyl]amino]-9-oxa-1,3-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-2-yl]-2-fluorobenzamide |
| SMILES | NC(=O)c1cc(-c2nc3cc(N[C@H](C(N)=O)C4CC4)cc4c3n2CCCO4)ccc1F |
| InChI | InChI=1S/C22H22FN5O3/c23-15-5-4-12(8-14(15)20(24)29)22-27-16-9-13(26-18(21(25)30)11-2-3-11)10-17-19(16)28(22)6-1-7-31-17/h4-5,8-11,18,26H,1-3,6-7H2,(H2,24,29)(H2,25,30)/t18-/m0/s1 |
| InChIKey | HQYGWOHXUGKATF-SFHVURJKSA-N |
| XLogP | 2.40 |
| TPSA | 125.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |