C19H29N5 — CID 126701293
4-[(4E,5Z)-4-[amino-(methylideneamino)methylidene]-2-butyl-5-cyclohexa-2,4-dien-1-ylideneimidazol-1-yl]butan-1-amine (PubChem CID 126701293) has the molecular formula C19H29N5 and a molecular weight of 327.48 g/mol. Its IUPAC name is 4-[(4E,5Z)-4-[amino-(methylideneamino)methylidene]-2-butyl-5-cyclohexa-2,4-dien-1-ylideneimidazol-1-yl]butan-1-amine.
| Compound Name | 4-[(4E,5Z)-4-[amino-(methylideneamino)methylidene]-2-butyl-5-cyclohexa-2,4-dien-1-ylideneimidazol-1-yl]butan-1-amine |
|---|---|
| PubChem CID | 126701293 |
| Molecular Formula | C19H29N5 |
| Molecular Weight | 327.48 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | 4-[(4E,5Z)-4-[amino-(methylideneamino)methylidene]-2-butyl-5-cyclohexa-2,4-dien-1-ylideneimidazol-1-yl]butan-1-amine |
| SMILES | C=N/C(N)=c1/nc(CCCC)n(CCCCN)/c1=C1\C=CC=CC1 |
| InChI | InChI=1S/C19H29N5/c1-3-4-12-16-23-17(19(21)22-2)18(15-10-6-5-7-11-15)24(16)14-9-8-13-20/h5-7,10H,2-4,8-9,11-14,20-21H2,1H3/b18-15+,19-17+ |
| InChIKey | AGOKDXURXNKJAH-RZBFYTONSA-N |
| XLogP | 1.36 |
| TPSA | 82.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.48 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|