About 1-(4,6-dimethylpyrimidin-2-yl)-3-[4-(trifluoromethoxy)phenyl]sulfonylurea
1-(4,6-dimethylpyrimidin-2-yl)-3-[4-(trifluoromethoxy)phenyl]sulfonylurea (PubChem CID 1267014) has the molecular formula C14H13F3N4O4S
and a molecular weight of 390.34 g/mol. Its IUPAC name is 1-(4,6-dimethylpyrimidin-2-yl)-3-[4-(trifluoromethoxy)phenyl]sulfonylurea.
Molecular Properties
| Compound Name | 1-(4,6-dimethylpyrimidin-2-yl)-3-[4-(trifluoromethoxy)phenyl]sulfonylurea |
| PubChem CID | 1267014 |
| Molecular Formula | C14H13F3N4O4S |
| Molecular Weight | 390.34 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 1-(4,6-dimethylpyrimidin-2-yl)-3-[4-(trifluoromethoxy)phenyl]sulfonylurea |
| SMILES | Cc1cc(C)nc(NC(=O)NS(=O)(=O)c2ccc(OC(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C14H13F3N4O4S/c1-8-7-9(2)19-12(18-8)20-13(22)21-26(23,24)11-5-3-10(4-6-11)25-14(15,16)17/h3-7H,1-2H3,(H2,18,19,20,21,22) |
| InChIKey | RIIYMDCLJTUIHW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(4,6-dimethylpyrimidin-2-yl)-3-[4-(trifluoromethoxy)phenyl]sulfonylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,6-dimethylpyrimidin-2-yl)-3-[4-(trifluoromethoxy)phenyl]sulfonylurea?
The IUPAC name of 1-(4,6-dimethylpyrimidin-2-yl)-3-[4-(trifluoromethoxy)phenyl]sulfonylurea (CID 1267014) is 1-(4,6-dimethylpyrimidin-2-yl)-3-[4-(trifluoromethoxy)phenyl]sulfonylurea.
What is the SMILES notation for 1-(4,6-dimethylpyrimidin-2-yl)-3-[4-(trifluoromethoxy)phenyl]sulfonylurea?
The canonical SMILES for 1-(4,6-dimethylpyrimidin-2-yl)-3-[4-(trifluoromethoxy)phenyl]sulfonylurea is Cc1cc(C)nc(NC(=O)NS(=O)(=O)c2ccc(OC(F)(F)F)cc2)n1.
What is the InChIKey of 1-(4,6-dimethylpyrimidin-2-yl)-3-[4-(trifluoromethoxy)phenyl]sulfonylurea?
The InChIKey is RIIYMDCLJTUIHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13F3N4O4S/c1-8-7-9(2)19-12(18-8)20-13(22)21-26(23,24)11-5-3-10(4-6-11)25-14(15,16)17/h3-7H,1-2H3,(H2,18,19,20,21,22).
What are the key properties of 1-(4,6-dimethylpyrimidin-2-yl)-3-[4-(trifluoromethoxy)phenyl]sulfonylurea?
1-(4,6-dimethylpyrimidin-2-yl)-3-[4-(trifluoromethoxy)phenyl]sulfonylurea has a molecular weight of 390.34 g/mol, XLogP of 2.50, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,6-dimethylpyrimidin-2-yl)-3-[4-(trifluoromethoxy)phenyl]sulfonylurea is sourced from PubChem (CID 1267014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).