About (Z)-3-[amino(ethyl)amino]hex-2-ene-1,2,6-triamine
(Z)-3-[amino(ethyl)amino]hex-2-ene-1,2,6-triamine (PubChem CID 126702023) has the molecular formula C8H21N5
and a molecular weight of 187.29 g/mol. Its IUPAC name is (Z)-3-[amino(ethyl)amino]hex-2-ene-1,2,6-triamine.
Molecular Properties
| Compound Name | (Z)-3-[amino(ethyl)amino]hex-2-ene-1,2,6-triamine |
| PubChem CID | 126702023 |
| Molecular Formula | C8H21N5 |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.18 |
| IUPAC Name | (Z)-3-[amino(ethyl)amino]hex-2-ene-1,2,6-triamine |
| SMILES | CCN(N)/C(CCCN)=C(\N)CN |
| InChI | InChI=1S/C8H21N5/c1-2-13(12)8(4-3-5-9)7(11)6-10/h2-6,9-12H2,1H3/b8-7- |
| InChIKey | BAPGSEGDNONDEV-FPLPWBNLSA-N |
| XLogP | -0.95 |
| TPSA | 107.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-[amino(ethyl)amino]hex-2-ene-1,2,6-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-[amino(ethyl)amino]hex-2-ene-1,2,6-triamine?
The IUPAC name of (Z)-3-[amino(ethyl)amino]hex-2-ene-1,2,6-triamine (CID 126702023) is (Z)-3-[amino(ethyl)amino]hex-2-ene-1,2,6-triamine.
What is the SMILES notation for (Z)-3-[amino(ethyl)amino]hex-2-ene-1,2,6-triamine?
The canonical SMILES for (Z)-3-[amino(ethyl)amino]hex-2-ene-1,2,6-triamine is CCN(N)/C(CCCN)=C(\N)CN.
What is the InChIKey of (Z)-3-[amino(ethyl)amino]hex-2-ene-1,2,6-triamine?
The InChIKey is BAPGSEGDNONDEV-FPLPWBNLSA-N. The full InChI is InChI=1S/C8H21N5/c1-2-13(12)8(4-3-5-9)7(11)6-10/h2-6,9-12H2,1H3/b8-7-.
What are the key properties of (Z)-3-[amino(ethyl)amino]hex-2-ene-1,2,6-triamine?
(Z)-3-[amino(ethyl)amino]hex-2-ene-1,2,6-triamine has a molecular weight of 187.29 g/mol, XLogP of -0.95, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-[amino(ethyl)amino]hex-2-ene-1,2,6-triamine is sourced from PubChem (CID 126702023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).