C9H15N3 — CID 126702180
1-[(2E,4Z)-hexa-2,4-dien-2-yl]-4,5-dihydroimidazol-2-amine (PubChem CID 126702180) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is 1-[(2E,4Z)-hexa-2,4-dien-2-yl]-4,5-dihydroimidazol-2-amine.
| Compound Name | 1-[(2E,4Z)-hexa-2,4-dien-2-yl]-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 126702180 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 1-[(2E,4Z)-hexa-2,4-dien-2-yl]-4,5-dihydroimidazol-2-amine |
| SMILES | C/C=C\C=C(/C)N1CCN=C1N |
| InChI | InChI=1S/C9H15N3/c1-3-4-5-8(2)12-7-6-11-9(12)10/h3-5H,6-7H2,1-2H3,(H2,10,11)/b4-3-,8-5+ |
| InChIKey | FHXQRDNGYDTBTP-HMRFFJRGSA-N |
| XLogP | 1.10 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|