About 1-(4-ethoxyphenyl)-N,4-diphenylazetidin-2-imine
1-(4-ethoxyphenyl)-N,4-diphenylazetidin-2-imine (PubChem CID 126702629) has the molecular formula C23H22N2O
and a molecular weight of 342.44 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-N,4-diphenylazetidin-2-imine.
Molecular Properties
| Compound Name | 1-(4-ethoxyphenyl)-N,4-diphenylazetidin-2-imine |
| PubChem CID | 126702629 |
| Molecular Formula | C23H22N2O |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 1-(4-ethoxyphenyl)-N,4-diphenylazetidin-2-imine |
| SMILES | CCOc1ccc(N2/C(=N/c3ccccc3)CC2c2ccccc2)cc1 |
| InChI | InChI=1S/C23H22N2O/c1-2-26-21-15-13-20(14-16-21)25-22(18-9-5-3-6-10-18)17-23(25)24-19-11-7-4-8-12-19/h3-16,22H,2,17H2,1H3/b24-23+ |
| InChIKey | GEXVRADCLLEROT-WCWDXBQESA-N |
| XLogP | 5.77 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-ethoxyphenyl)-N,4-diphenylazetidin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-ethoxyphenyl)-N,4-diphenylazetidin-2-imine?
The IUPAC name of 1-(4-ethoxyphenyl)-N,4-diphenylazetidin-2-imine (CID 126702629) is 1-(4-ethoxyphenyl)-N,4-diphenylazetidin-2-imine.
What is the SMILES notation for 1-(4-ethoxyphenyl)-N,4-diphenylazetidin-2-imine?
The canonical SMILES for 1-(4-ethoxyphenyl)-N,4-diphenylazetidin-2-imine is CCOc1ccc(N2/C(=N/c3ccccc3)CC2c2ccccc2)cc1.
What is the InChIKey of 1-(4-ethoxyphenyl)-N,4-diphenylazetidin-2-imine?
The InChIKey is GEXVRADCLLEROT-WCWDXBQESA-N. The full InChI is InChI=1S/C23H22N2O/c1-2-26-21-15-13-20(14-16-21)25-22(18-9-5-3-6-10-18)17-23(25)24-19-11-7-4-8-12-19/h3-16,22H,2,17H2,1H3/b24-23+.
What are the key properties of 1-(4-ethoxyphenyl)-N,4-diphenylazetidin-2-imine?
1-(4-ethoxyphenyl)-N,4-diphenylazetidin-2-imine has a molecular weight of 342.44 g/mol, XLogP of 5.77, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-ethoxyphenyl)-N,4-diphenylazetidin-2-imine is sourced from PubChem (CID 126702629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).