About (3R)-3-ethyl-4,5-dimethyl-2,3-dihydrothiophen-2-amine
(3R)-3-ethyl-4,5-dimethyl-2,3-dihydrothiophen-2-amine (PubChem CID 126702660) has the molecular formula C8H15NS
and a molecular weight of 157.28 g/mol. Its IUPAC name is (3R)-3-ethyl-4,5-dimethyl-2,3-dihydrothiophen-2-amine.
Molecular Properties
| Compound Name | (3R)-3-ethyl-4,5-dimethyl-2,3-dihydrothiophen-2-amine |
| PubChem CID | 126702660 |
| Molecular Formula | C8H15NS |
| Molecular Weight | 157.28 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | (3R)-3-ethyl-4,5-dimethyl-2,3-dihydrothiophen-2-amine |
| SMILES | CC[C@@H]1C(C)=C(C)SC1N |
| InChI | InChI=1S/C8H15NS/c1-4-7-5(2)6(3)10-8(7)9/h7-8H,4,9H2,1-3H3/t7-,8?/m1/s1 |
| InChIKey | XADXVYAQDQPIGZ-GVHYBUMESA-N |
| XLogP | 2.34 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.28 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-3-ethyl-4,5-dimethyl-2,3-dihydrothiophen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-ethyl-4,5-dimethyl-2,3-dihydrothiophen-2-amine?
The IUPAC name of (3R)-3-ethyl-4,5-dimethyl-2,3-dihydrothiophen-2-amine (CID 126702660) is (3R)-3-ethyl-4,5-dimethyl-2,3-dihydrothiophen-2-amine.
What is the SMILES notation for (3R)-3-ethyl-4,5-dimethyl-2,3-dihydrothiophen-2-amine?
The canonical SMILES for (3R)-3-ethyl-4,5-dimethyl-2,3-dihydrothiophen-2-amine is CC[C@@H]1C(C)=C(C)SC1N.
What is the InChIKey of (3R)-3-ethyl-4,5-dimethyl-2,3-dihydrothiophen-2-amine?
The InChIKey is XADXVYAQDQPIGZ-GVHYBUMESA-N. The full InChI is InChI=1S/C8H15NS/c1-4-7-5(2)6(3)10-8(7)9/h7-8H,4,9H2,1-3H3/t7-,8?/m1/s1.
What are the key properties of (3R)-3-ethyl-4,5-dimethyl-2,3-dihydrothiophen-2-amine?
(3R)-3-ethyl-4,5-dimethyl-2,3-dihydrothiophen-2-amine has a molecular weight of 157.28 g/mol, XLogP of 2.34, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-ethyl-4,5-dimethyl-2,3-dihydrothiophen-2-amine is sourced from PubChem (CID 126702660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).