C20H20Cl3NO2 — CID 126702708
1-chloroethyl N-[(4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-N-methylcarbamate (PubChem CID 126702708) has the molecular formula C20H20Cl3NO2 and a molecular weight of 412.74 g/mol. Its IUPAC name is 1-chloroethyl N-[(4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-N-methylcarbamate.
| Compound Name | 1-chloroethyl N-[(4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 126702708 |
| Molecular Formula | C20H20Cl3NO2 |
| Molecular Weight | 412.74 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | 1-chloroethyl N-[(4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-N-methylcarbamate |
| SMILES | CC(Cl)OC(=O)N(C)C1CC[C@@H](c2ccc(Cl)c(Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C20H20Cl3NO2/c1-12(21)26-20(25)24(2)19-10-8-14(15-5-3-4-6-16(15)19)13-7-9-17(22)18(23)11-13/h3-7,9,11-12,14,19H,8,10H2,1-2H3/t12?,14-,19?/m0/s1 |
| InChIKey | VQNYMICPHQITQL-MMSRSVNZSA-N |
| XLogP | 6.61 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.74 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|