C11H20F2O — CID 126702754
2-(1,1-difluoroethyl)-3,4,5,6-tetramethyloxane (PubChem CID 126702754) has the molecular formula C11H20F2O and a molecular weight of 206.28 g/mol. Its IUPAC name is 2-(1,1-difluoroethyl)-3,4,5,6-tetramethyloxane.
| Compound Name | 2-(1,1-difluoroethyl)-3,4,5,6-tetramethyloxane |
|---|---|
| PubChem CID | 126702754 |
| Molecular Formula | C11H20F2O |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 2-(1,1-difluoroethyl)-3,4,5,6-tetramethyloxane |
| SMILES | CC1OC(C(C)(F)F)C(C)C(C)C1C |
| InChI | InChI=1S/C11H20F2O/c1-6-7(2)9(4)14-10(8(6)3)11(5,12)13/h6-10H,1-5H3 |
| InChIKey | OKVICDXNYDCLJW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |